About 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride
7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride (PubChem CID 155527878) has the molecular formula C18H19Cl2N3
and a molecular weight of 348.28 g/mol. Its IUPAC name is 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride |
| PubChem CID | 155527878 |
| Molecular Formula | C18H19Cl2N3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride |
| SMILES | Cc1cc(N)nc2cc(-c3cccc4c3CNC4)ccc12.Cl.Cl |
| InChI | InChI=1S/C18H17N3.2ClH/c1-11-7-18(19)21-17-8-12(5-6-14(11)17)15-4-2-3-13-9-20-10-16(13)15;;/h2-8,20H,9-10H2,1H3,(H2,19,21);2*1H |
| InChIKey | CYZBUGCELOCSLB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride?
The IUPAC name of 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride (CID 155527878) is 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride.
What is the SMILES notation for 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride?
The canonical SMILES for 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride is Cc1cc(N)nc2cc(-c3cccc4c3CNC4)ccc12.Cl.Cl.
What is the InChIKey of 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride?
The InChIKey is CYZBUGCELOCSLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3.2ClH/c1-11-7-18(19)21-17-8-12(5-6-14(11)17)15-4-2-3-13-9-20-10-16(13)15;;/h2-8,20H,9-10H2,1H3,(H2,19,21);2*1H.
What are the key properties of 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride?
7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride has a molecular weight of 348.28 g/mol, XLogP of 4.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,3-dihydro-1H-isoindol-4-yl)-4-methylquinolin-2-amine;dihydrochloride is sourced from PubChem (CID 155527878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).