C25H23F3N4O3S — CID 155528173
3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]propanamide (PubChem CID 155528173) has the molecular formula C25H23F3N4O3S and a molecular weight of 516.55 g/mol. Its IUPAC name is 3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]propanamide.
| Compound Name | 3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 155528173 |
| Molecular Formula | C25H23F3N4O3S |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]-N-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2cnc3[nH]ccc3c2)cc1)NCCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23F3N4O3S/c26-25(27,28)21-2-1-3-22(15-21)36(34,35)32-13-12-29-23(33)9-6-17-4-7-18(8-5-17)20-14-19-10-11-30-24(19)31-16-20/h1-5,7-8,10-11,14-16,32H,6,9,12-13H2,(H,29,33)(H,30,31) |
| InChIKey | UXXTWZUOKYKICY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|