C20H16N2O4S — CID 155528222
4-(1-benzofuran-2-yl)-5-methyl-7-phenyl-3,4-dihydrooxathiino[5,6-d]pyrazole 2,2-dioxide (PubChem CID 155528222) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-5-methyl-7-phenyl-3,4-dihydrooxathiino[5,6-d]pyrazole 2,2-dioxide.
| Compound Name | 4-(1-benzofuran-2-yl)-5-methyl-7-phenyl-3,4-dihydrooxathiino[5,6-d]pyrazole 2,2-dioxide |
|---|---|
| PubChem CID | 155528222 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-5-methyl-7-phenyl-3,4-dihydrooxathiino[5,6-d]pyrazole 2,2-dioxide |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1cc3ccccc3o1)CS(=O)(=O)O2 |
| InChI | InChI=1S/C20H16N2O4S/c1-13-19-16(18-11-14-7-5-6-10-17(14)25-18)12-27(23,24)26-20(19)22(21-13)15-8-3-2-4-9-15/h2-11,16H,12H2,1H3 |
| InChIKey | ZDILEPZHIMZIJG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|