C21H24N8O3S — CID 155528294
5-amino-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155528294) has the molecular formula C21H24N8O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-amino-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-amino-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155528294 |
| Molecular Formula | C21H24N8O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-amino-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Nc1nc(C(=O)N/N=C/c2ccc(N3CCCCC3)cc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H24N8O3S/c22-21-25-19(27-29(21)17-8-10-18(11-9-17)33(23,31)32)20(30)26-24-14-15-4-6-16(7-5-15)28-12-2-1-3-13-28/h4-11,14H,1-3,12-13H2,(H,26,30)(H2,22,25,27)(H2,23,31,32)/b24-14+ |
| InChIKey | WEUXRDYAXRZXBQ-ZVHZXABRSA-N |
| XLogP | 1.25 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|