About 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one
4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one (PubChem CID 155528387) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one.
Molecular Properties
| Compound Name | 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one |
| PubChem CID | 155528387 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one |
| SMILES | CC1=CC(OC2C[C@H](C)CC[C@H]2C(C)C)OC1=O |
| InChI | InChI=1S/C15H24O3/c1-9(2)12-6-5-10(3)7-13(12)17-14-8-11(4)15(16)18-14/h8-10,12-14H,5-7H2,1-4H3/t10-,12+,13?,14?/m1/s1 |
| InChIKey | LXCATODYSLMRIA-IKMSWONJSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one?
The IUPAC name of 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one (CID 155528387) is 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one.
What is the SMILES notation for 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one?
The canonical SMILES for 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one is CC1=CC(OC2C[C@H](C)CC[C@H]2C(C)C)OC1=O.
What is the InChIKey of 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one?
The InChIKey is LXCATODYSLMRIA-IKMSWONJSA-N. The full InChI is InChI=1S/C15H24O3/c1-9(2)12-6-5-10(3)7-13(12)17-14-8-11(4)15(16)18-14/h8-10,12-14H,5-7H2,1-4H3/t10-,12+,13?,14?/m1/s1.
What are the key properties of 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one?
4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one has a molecular weight of 252.35 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2H-furan-5-one is sourced from PubChem (CID 155528387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).