C23H28N2O3 — CID 155528419
2-(4-methoxyphenyl)ethyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate (PubChem CID 155528419) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate.
| Compound Name | 2-(4-methoxyphenyl)ethyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate |
|---|---|
| PubChem CID | 155528419 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate |
| SMILES | COc1ccc(CCOC(=O)N(c2ccccc2)C2CN3CCC2CC3)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-27-21-9-7-18(8-10-21)13-16-28-23(26)25(20-5-3-2-4-6-20)22-17-24-14-11-19(22)12-15-24/h2-10,19,22H,11-17H2,1H3 |
| InChIKey | HLFXMJFGYOOILI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |