C35H32F3N7O — CID 155528463
3-[2-[6-(4-aminophenyl)imidazo[1,2-a]pyrazin-3-yl]ethynyl]-2-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 155528463) has the molecular formula C35H32F3N7O and a molecular weight of 623.68 g/mol. Its IUPAC name is 3-[2-[6-(4-aminophenyl)imidazo[1,2-a]pyrazin-3-yl]ethynyl]-2-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-[6-(4-aminophenyl)imidazo[1,2-a]pyrazin-3-yl]ethynyl]-2-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 155528463 |
| Molecular Formula | C35H32F3N7O |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | 3-[2-[6-(4-aminophenyl)imidazo[1,2-a]pyrazin-3-yl]ethynyl]-2-methyl-N-[3-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1c(C#Cc2cnc3cnc(-c4ccc(N)cc4)cn23)cccc1C(=O)Nc1cc(CN2CCN(C)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H32F3N7O/c1-23-25(8-11-30-19-41-33-20-40-32(22-45(30)33)26-6-9-28(39)10-7-26)4-3-5-31(23)34(46)42-29-17-24(16-27(18-29)35(36,37)38)21-44-14-12-43(2)13-15-44/h3-7,9-10,16-20,22H,12-15,21,39H2,1-2H3,(H,42,46) |
| InChIKey | ZBSQPLKGTYVAIB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|