C22H22O8 — CID 155528646
5-hydroxy-7,8,9,10-tetramethoxy-2,2-dimethylpyrano[3,2-b]xanthen-6-one (PubChem CID 155528646) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is 5-hydroxy-7,8,9,10-tetramethoxy-2,2-dimethylpyrano[3,2-b]xanthen-6-one.
| Compound Name | 5-hydroxy-7,8,9,10-tetramethoxy-2,2-dimethylpyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 155528646 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-hydroxy-7,8,9,10-tetramethoxy-2,2-dimethylpyrano[3,2-b]xanthen-6-one |
| SMILES | COc1c(OC)c(OC)c2c(=O)c3c(O)c4c(cc3oc2c1OC)OC(C)(C)C=C4 |
| InChI | InChI=1S/C22H22O8/c1-22(2)8-7-10-11(30-22)9-12-13(15(10)23)16(24)14-17(25-3)19(26-4)21(28-6)20(27-5)18(14)29-12/h7-9,23H,1-6H3 |
| InChIKey | HTKCMAWVRUHFSK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|