C25H35NO8 — CID 155528857
N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]heptanamide (PubChem CID 155528857) has the molecular formula C25H35NO8 and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]heptanamide.
| Compound Name | N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]heptanamide |
|---|---|
| PubChem CID | 155528857 |
| Molecular Formula | C25H35NO8 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1cc2ccc(O[C@@H]3OC(C)(C)[C@H](OC)[C@@H](O)[C@H]3O)c(C)c2oc1=O |
| InChI | InChI=1S/C25H35NO8/c1-6-7-8-9-10-18(27)26-16-13-15-11-12-17(14(2)21(15)33-23(16)30)32-24-20(29)19(28)22(31-5)25(3,4)34-24/h11-13,19-20,22,24,28-29H,6-10H2,1-5H3,(H,26,27)/t19-,20+,22+,24+/m0/s1 |
| InChIKey | XXVKMSDIMRBYBS-LNGMVNIQSA-N |
| XLogP | 3.26 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|