C20H32O3 — CID 155528878
(1S,6S,8S,9R,10R,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,8]hexadec-3-ene-6,9,14-triol (PubChem CID 155528878) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,6S,8S,9R,10R,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,8]hexadec-3-ene-6,9,14-triol.
| Compound Name | (1S,6S,8S,9R,10R,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,8]hexadec-3-ene-6,9,14-triol |
|---|---|
| PubChem CID | 155528878 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,6S,8S,9R,10R,13R,14R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,8]hexadec-3-ene-6,9,14-triol |
| SMILES | CC1(C)C2=CC[C@@]34C[C@@H](CC[C@H]3[C@@](C)(O)[C@H]2C[C@@H]1O)[C@](C)(O)C4 |
| InChI | InChI=1S/C20H32O3/c1-17(2)13-7-8-20-10-12(18(3,22)11-20)5-6-15(20)19(4,23)14(13)9-16(17)21/h7,12,14-16,21-23H,5-6,8-11H2,1-4H3/t12-,14+,15+,16+,18-,19+,20+/m1/s1 |
| InChIKey | NBDWLPBRLBBEHX-GEOBFZLQSA-N |
| XLogP | 3.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|