C20H28N10O2 — CID 155529152
9,19-dicyclopentyl-4,14-dioxa-1,3,5,7,9,11,13,15,17,19-decazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-2,5,12,15-tetraene (PubChem CID 155529152) has the molecular formula C20H28N10O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 9,19-dicyclopentyl-4,14-dioxa-1,3,5,7,9,11,13,15,17,19-decazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-2,5,12,15-tetraene.
| Compound Name | 9,19-dicyclopentyl-4,14-dioxa-1,3,5,7,9,11,13,15,17,19-decazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-2,5,12,15-tetraene |
|---|---|
| PubChem CID | 155529152 |
| Molecular Formula | C20H28N10O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 9,19-dicyclopentyl-4,14-dioxa-1,3,5,7,9,11,13,15,17,19-decazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-2,5,12,15-tetraene |
| SMILES | C1CCC(N2CN3c4nonc4N4CN(C5CCCC5)CN5c6nonc6N(C2)C3C45)C1 |
| InChI | InChI=1S/C20H28N10O2/c1-2-6-13(5-1)25-9-27-15-17(23-31-21-15)29-11-26(14-7-3-4-8-14)12-30-18-16(22-32-24-18)28(10-25)19(27)20(29)30/h13-14,19-20H,1-12H2 |
| InChIKey | LEOSEOVLVOWFEP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |