C24H28Cl2N4O4 — CID 155529285
4-[3-[4-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]butoxy]phenoxy]butanoic acid;hydrochloride (PubChem CID 155529285) has the molecular formula C24H28Cl2N4O4 and a molecular weight of 507.42 g/mol. Its IUPAC name is 4-[3-[4-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]butoxy]phenoxy]butanoic acid;hydrochloride.
| Compound Name | 4-[3-[4-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]butoxy]phenoxy]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 155529285 |
| Molecular Formula | C24H28Cl2N4O4 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 4-[3-[4-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]butoxy]phenoxy]butanoic acid;hydrochloride |
| SMILES | Cl.Nc1nc(N)c(-c2cccc(Cl)c2)c(CCCCOc2cccc(OCCCC(=O)O)c2)n1 |
| InChI | InChI=1S/C24H27ClN4O4.ClH/c25-17-7-3-6-16(14-17)22-20(28-24(27)29-23(22)26)10-1-2-12-32-18-8-4-9-19(15-18)33-13-5-11-21(30)31;/h3-4,6-9,14-15H,1-2,5,10-13H2,(H,30,31)(H4,26,27,28,29);1H |
| InChIKey | GIJIXUSQXSCXQP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|