About 3-hexylimidazo[1,2-a]pyrazin-8-amine
3-hexylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 155529356) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-hexylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-hexylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 155529356 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-hexylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCCCCCc1cnc2c(N)nccn12 |
| InChI | InChI=1S/C12H18N4/c1-2-3-4-5-6-10-9-15-12-11(13)14-7-8-16(10)12/h7-9H,2-6H2,1H3,(H2,13,14) |
| InChIKey | QKRFCSVGKPSUGR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 3-hexylimidazo[1,2-a]pyrazin-8-amine (CID 155529356) is 3-hexylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 3-hexylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 3-hexylimidazo[1,2-a]pyrazin-8-amine is CCCCCCc1cnc2c(N)nccn12.
What is the InChIKey of 3-hexylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is QKRFCSVGKPSUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-2-3-4-5-6-10-9-15-12-11(13)14-7-8-16(10)12/h7-9H,2-6H2,1H3,(H2,13,14).
What are the key properties of 3-hexylimidazo[1,2-a]pyrazin-8-amine?
3-hexylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 218.30 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 155529356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).