C30H34F3N5O3 — CID 155529363
N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 155529363) has the molecular formula C30H34F3N5O3 and a molecular weight of 569.63 g/mol. Its IUPAC name is N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155529363 |
| Molecular Formula | C30H34F3N5O3 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cnn(-c2ccccc2)c1C(F)(F)F)c1ccc(C(=O)N[C@@H](CCC2CCCCC2)C(N)=O)cc1 |
| InChI | InChI=1S/C30H34F3N5O3/c1-19(36-29(41)24-18-35-38(26(24)30(31,32)33)23-10-6-3-7-11-23)21-13-15-22(16-14-21)28(40)37-25(27(34)39)17-12-20-8-4-2-5-9-20/h3,6-7,10-11,13-16,18-20,25H,2,4-5,8-9,12,17H2,1H3,(H2,34,39)(H,36,41)(H,37,40)/t19?,25-/m0/s1 |
| InChIKey | PHCMXROCRKFVAJ-BIAFCPFJSA-N |
| XLogP | 5.33 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |