C23H24ClN5O4S — CID 155529373
(2S,3S)-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide (PubChem CID 155529373) has the molecular formula C23H24ClN5O4S and a molecular weight of 502.00 g/mol. Its IUPAC name is (2S,3S)-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155529373 |
| Molecular Formula | C23H24ClN5O4S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (2S,3S)-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)C[C@H](C(=O)NCCCn3ccnc3)[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H24ClN5O4S/c24-17-4-2-16(3-5-17)22-20(23(31)27-10-1-12-28-13-11-26-15-28)14-21(30)29(22)18-6-8-19(9-7-18)34(25,32)33/h2-9,11,13,15,20,22H,1,10,12,14H2,(H,27,31)(H2,25,32,33)/t20-,22+/m0/s1 |
| InChIKey | ICBZOYHXUKPRCT-RBBKRZOGSA-N |
| XLogP | 2.48 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|