C22H28O6 — CID 155529407
[(3aS,4R,9S,10Z,11aR)-4-[(Z)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate (PubChem CID 155529407) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(3aS,4R,9S,10Z,11aR)-4-[(Z)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate.
| Compound Name | [(3aS,4R,9S,10Z,11aR)-4-[(Z)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate |
|---|---|
| PubChem CID | 155529407 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(3aS,4R,9S,10Z,11aR)-4-[(Z)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)[C@@H](OC(C)=O)CC=C(C)C[C@@H](C(=O)/C(C)=C\CO)[C@@H]12 |
| InChI | InChI=1S/C22H28O6/c1-12-6-7-18(27-16(5)24)14(3)11-19-20(15(4)22(26)28-19)17(10-12)21(25)13(2)8-9-23/h6,8,11,17-20,23H,4,7,9-10H2,1-3,5H3/b12-6?,13-8-,14-11-/t17-,18+,19-,20-/m1/s1 |
| InChIKey | TYCOTEHYVXXPSO-AZMRBCRISA-N |
| XLogP | 2.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|