C21H26N2O — CID 155529437
(12aS)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline (PubChem CID 155529437) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (12aS)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline.
| Compound Name | (12aS)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
|---|---|
| PubChem CID | 155529437 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (12aS)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
| SMILES | COc1ccc2c(c1)[C@@]1(C)Cc3cnc(C)nc3C(C)(C)C1CC2 |
| InChI | InChI=1S/C21H26N2O/c1-13-22-12-15-11-21(4)17-10-16(24-5)8-6-14(17)7-9-18(21)20(2,3)19(15)23-13/h6,8,10,12,18H,7,9,11H2,1-5H3/t18?,21-/m1/s1 |
| InChIKey | HUPFIZZYUGGUIE-BDPMCISCSA-N |
| XLogP | 4.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |