About N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide
N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide (PubChem CID 155529478) has the molecular formula C24H24N4O
and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide |
| PubChem CID | 155529478 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide |
| SMILES | CN(C)CCN(C)C(=O)c1cc2c3ccccc3[nH]c2c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C24H24N4O/c1-27(2)12-13-28(3)24(29)18-14-17-15-8-4-6-10-19(15)25-22(17)21-16-9-5-7-11-20(16)26-23(18)21/h4-11,14,25-26H,12-13H2,1-3H3 |
| InChIKey | GCAZSFFCWTWHFU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
The IUPAC name of N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide (CID 155529478) is N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide is CN(C)CCN(C)C(=O)c1cc2c3ccccc3[nH]c2c2c1[nH]c1ccccc12.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
The InChIKey is GCAZSFFCWTWHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O/c1-27(2)12-13-28(3)24(29)18-14-17-15-8-4-6-10-19(15)25-22(17)21-16-9-5-7-11-20(16)26-23(18)21/h4-11,14,25-26H,12-13H2,1-3H3.
What are the key properties of N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide has a molecular weight of 384.48 g/mol, XLogP of 4.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-N-methyl-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide is sourced from PubChem (CID 155529478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).