C35H40N6O4S — CID 155529536
(2R)-2-(benzylsulfonylamino)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-5-phenylpentanamide (PubChem CID 155529536) has the molecular formula C35H40N6O4S and a molecular weight of 640.81 g/mol. Its IUPAC name is (2R)-2-(benzylsulfonylamino)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-5-phenylpentanamide.
| Compound Name | (2R)-2-(benzylsulfonylamino)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 155529536 |
| Molecular Formula | C35H40N6O4S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | (2R)-2-(benzylsulfonylamino)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxo-4-pyridin-4-ylbutan-2-yl]-5-phenylpentanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCc2ccncc2)NC(=O)[C@@H](CCCc2ccccc2)NS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H40N6O4S/c36-33(37)30-17-14-28(15-18-30)24-39-34(42)31(19-16-27-20-22-38-23-21-27)40-35(43)32(13-7-12-26-8-3-1-4-9-26)41-46(44,45)25-29-10-5-2-6-11-29/h1-6,8-11,14-15,17-18,20-23,31-32,41H,7,12-13,16,19,24-25H2,(H3,36,37)(H,39,42)(H,40,43)/t31-,32+/m0/s1 |
| InChIKey | OUGUMFKJMHXPKT-AJQTZOPKSA-N |
| XLogP | 3.61 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|