C28H34FNO15 — CID 155529687
methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(phenylmethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 155529687) has the molecular formula C28H34FNO15 and a molecular weight of 643.57 g/mol. Its IUPAC name is methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(phenylmethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(phenylmethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 155529687 |
| Molecular Formula | C28H34FNO15 |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(phenylmethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(=O)OCc2ccccc2)[C@@H](OC(C)=O)[C@H]1F |
| InChI | InChI=1S/C28H34FNO15/c1-14(31)39-13-20(41-15(2)32)22(42-16(3)33)23-21(30-27(37)40-12-19-10-8-7-9-11-19)24(43-17(4)34)25(29)28(45-23,26(36)38-6)44-18(5)35/h7-11,20-25H,12-13H2,1-6H3,(H,30,37)/t20-,21+,22-,23-,24-,25-,28?/m1/s1 |
| InChIKey | ZPUGLWROHCWNLU-FMZLTFPESA-N |
| XLogP | 0.81 |
| TPSA | 205.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|