About tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate
tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate (PubChem CID 155529746) has the molecular formula C24H27N3O2
and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate |
| PubChem CID | 155529746 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cc(/C=C/c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C24H27N3O2/c1-24(2,3)29-23(28)26-16-15-25-22-17-19(14-13-18-9-5-4-6-10-18)27-21-12-8-7-11-20(21)22/h4-14,17H,15-16H2,1-3H3,(H,25,27)(H,26,28)/b14-13+ |
| InChIKey | SEQUVFRZXCPWHE-BUHFOSPRSA-N |
| XLogP | 5.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate (CID 155529746) is tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate is CC(C)(C)OC(=O)NCCNc1cc(/C=C/c2ccccc2)nc2ccccc12.
What is the InChIKey of tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate?
The InChIKey is SEQUVFRZXCPWHE-BUHFOSPRSA-N. The full InChI is InChI=1S/C24H27N3O2/c1-24(2,3)29-23(28)26-16-15-25-22-17-19(14-13-18-9-5-4-6-10-18)27-21-12-8-7-11-20(21)22/h4-14,17H,15-16H2,1-3H3,(H,25,27)(H,26,28)/b14-13+.
What are the key properties of tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate?
tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate has a molecular weight of 389.50 g/mol, XLogP of 5.34, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[[2-[(E)-2-phenylethenyl]quinolin-4-yl]amino]ethyl]carbamate is sourced from PubChem (CID 155529746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).