About (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide
(E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide (PubChem CID 155529845) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide |
| PubChem CID | 155529845 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C13H17NO3/c1-3-14(4-2)13(17)8-6-10-5-7-11(15)9-12(10)16/h5-9,15-16H,3-4H2,1-2H3/b8-6+ |
| InChIKey | MUVKMPNGDZPBBV-SOFGYWHQSA-N |
| XLogP | 1.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide?
The IUPAC name of (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide (CID 155529845) is (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide.
What is the SMILES notation for (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide?
The canonical SMILES for (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide is CCN(CC)C(=O)/C=C/c1ccc(O)cc1O.
What is the InChIKey of (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide?
The InChIKey is MUVKMPNGDZPBBV-SOFGYWHQSA-N. The full InChI is InChI=1S/C13H17NO3/c1-3-14(4-2)13(17)8-6-10-5-7-11(15)9-12(10)16/h5-9,15-16H,3-4H2,1-2H3/b8-6+.
What are the key properties of (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide?
(E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide has a molecular weight of 235.28 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide is sourced from PubChem (CID 155529845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).