About (E)-3-phenyl-N'-propylprop-2-enehydrazide
(E)-3-phenyl-N'-propylprop-2-enehydrazide (PubChem CID 155529994) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is (E)-3-phenyl-N'-propylprop-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-3-phenyl-N'-propylprop-2-enehydrazide |
| PubChem CID | 155529994 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (E)-3-phenyl-N'-propylprop-2-enehydrazide |
| SMILES | CCCNNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-2-10-13-14-12(15)9-8-11-6-4-3-5-7-11/h3-9,13H,2,10H2,1H3,(H,14,15)/b9-8+ |
| InChIKey | OZCDQJDLGNGSGG-CMDGGOBGSA-N |
| XLogP | 1.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-phenyl-N'-propylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-phenyl-N'-propylprop-2-enehydrazide?
The IUPAC name of (E)-3-phenyl-N'-propylprop-2-enehydrazide (CID 155529994) is (E)-3-phenyl-N'-propylprop-2-enehydrazide.
What is the SMILES notation for (E)-3-phenyl-N'-propylprop-2-enehydrazide?
The canonical SMILES for (E)-3-phenyl-N'-propylprop-2-enehydrazide is CCCNNC(=O)/C=C/c1ccccc1.
What is the InChIKey of (E)-3-phenyl-N'-propylprop-2-enehydrazide?
The InChIKey is OZCDQJDLGNGSGG-CMDGGOBGSA-N. The full InChI is InChI=1S/C12H16N2O/c1-2-10-13-14-12(15)9-8-11-6-4-3-5-7-11/h3-9,13H,2,10H2,1H3,(H,14,15)/b9-8+.
What are the key properties of (E)-3-phenyl-N'-propylprop-2-enehydrazide?
(E)-3-phenyl-N'-propylprop-2-enehydrazide has a molecular weight of 204.27 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-phenyl-N'-propylprop-2-enehydrazide is sourced from PubChem (CID 155529994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).