C19H20O4 — CID 155530015
(1R,11S,12R,13R,18S)-18-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione (PubChem CID 155530015) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (1R,11S,12R,13R,18S)-18-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione.
| Compound Name | (1R,11S,12R,13R,18S)-18-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
|---|---|
| PubChem CID | 155530015 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (1R,11S,12R,13R,18S)-18-hydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
| SMILES | Cc1cc(=O)cc2c3c1[C@@H](O)[C@H]1[C@@H]3[C@]3(CC2)C(=O)O[C@@H]1CC3C |
| InChI | InChI=1S/C19H20O4/c1-8-5-11(20)7-10-3-4-19-9(2)6-12(23-18(19)22)15-16(19)14(10)13(8)17(15)21/h5,7,9,12,15-17,21H,3-4,6H2,1-2H3/t9?,12-,15-,16-,17-,19-/m1/s1 |
| InChIKey | MRTSZHTXECODOE-BOACDHTHSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |