C21H26N4O5S2 — CID 155530178
3-[2-(2,5-dimethoxyphenyl)ethoxy]-N,N-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-sulfonamide (PubChem CID 155530178) has the molecular formula C21H26N4O5S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-[2-(2,5-dimethoxyphenyl)ethoxy]-N,N-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-sulfonamide.
| Compound Name | 3-[2-(2,5-dimethoxyphenyl)ethoxy]-N,N-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-sulfonamide |
|---|---|
| PubChem CID | 155530178 |
| Molecular Formula | C21H26N4O5S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[2-(2,5-dimethoxyphenyl)ethoxy]-N,N-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-sulfonamide |
| SMILES | COc1ccc(OC)c(CCOc2ncnc3sc4c(c23)CCN(S(=O)(=O)N(C)C)C4)c1 |
| InChI | InChI=1S/C21H26N4O5S2/c1-24(2)32(26,27)25-9-7-16-18(12-25)31-21-19(16)20(22-13-23-21)30-10-8-14-11-15(28-3)5-6-17(14)29-4/h5-6,11,13H,7-10,12H2,1-4H3 |
| InChIKey | XFQIQNBCLGRSFE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |