About cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate
cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate (PubChem CID 155530191) has the molecular formula C23H25N3O3S
and a molecular weight of 423.54 g/mol. Its IUPAC name is cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate |
| PubChem CID | 155530191 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate |
| SMILES | CC(=O)Nc1nc2ccc(-c3cnc(C)c(CC(=O)OC4CCCCC4)c3)cc2s1 |
| InChI | InChI=1S/C23H25N3O3S/c1-14-17(12-22(28)29-19-6-4-3-5-7-19)10-18(13-24-14)16-8-9-20-21(11-16)30-23(26-20)25-15(2)27/h8-11,13,19H,3-7,12H2,1-2H3,(H,25,26,27) |
| InChIKey | WLAXMYKSWGIJKU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate?
The IUPAC name of cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate (CID 155530191) is cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate.
What is the SMILES notation for cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate?
The canonical SMILES for cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate is CC(=O)Nc1nc2ccc(-c3cnc(C)c(CC(=O)OC4CCCCC4)c3)cc2s1.
What is the InChIKey of cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate?
The InChIKey is WLAXMYKSWGIJKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O3S/c1-14-17(12-22(28)29-19-6-4-3-5-7-19)10-18(13-24-14)16-8-9-20-21(11-16)30-23(26-20)25-15(2)27/h8-11,13,19H,3-7,12H2,1-2H3,(H,25,26,27).
What are the key properties of cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate?
cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate has a molecular weight of 423.54 g/mol, XLogP of 5.04, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-[5-(2-acetamido-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]acetate is sourced from PubChem (CID 155530191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).