C13H10ClF3N4OS2 — CID 155530255
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea (PubChem CID 155530255) has the molecular formula C13H10ClF3N4OS2 and a molecular weight of 394.83 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea |
|---|---|
| PubChem CID | 155530255 |
| Molecular Formula | C13H10ClF3N4OS2 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)urea |
| SMILES | C=CCSc1nc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)ns1 |
| InChI | InChI=1S/C13H10ClF3N4OS2/c1-2-5-23-12-20-10(21-24-12)19-11(22)18-7-3-4-9(14)8(6-7)13(15,16)17/h2-4,6H,1,5H2,(H2,18,19,21,22) |
| InChIKey | UEIBBINZKBVEJX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|