About (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate
(2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate (PubChem CID 155530334) has the molecular formula C19H28ClN3O2S2
and a molecular weight of 430.04 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate |
| PubChem CID | 155530334 |
| Molecular Formula | C19H28ClN3O2S2 |
| Molecular Weight | 430.04 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate |
| SMILES | CN1CCC(SC(=S)NCCCCNC(=O)OCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClN3O2S2/c1-23-12-8-16(9-13-23)27-19(26)22-11-5-4-10-21-18(24)25-14-15-6-2-3-7-17(15)20/h2-3,6-7,16H,4-5,8-14H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | CBXNXRROQHXEIR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate?
The IUPAC name of (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate (CID 155530334) is (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate.
What is the SMILES notation for (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate?
The canonical SMILES for (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate is CN1CCC(SC(=S)NCCCCNC(=O)OCc2ccccc2Cl)CC1.
What is the InChIKey of (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate?
The InChIKey is CBXNXRROQHXEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28ClN3O2S2/c1-23-12-8-16(9-13-23)27-19(26)22-11-5-4-10-21-18(24)25-14-15-6-2-3-7-17(15)20/h2-3,6-7,16H,4-5,8-14H2,1H3,(H,21,24)(H,22,26).
What are the key properties of (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate?
(2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate has a molecular weight of 430.04 g/mol, XLogP of 4.05, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl N-[4-[(1-methylpiperidin-4-yl)sulfanylcarbothioylamino]butyl]carbamate is sourced from PubChem (CID 155530334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).