C16H19NO5S — CID 155530355
N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 155530355) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 155530355 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | C[C@@H]1O[C@H](CNC(=O)c2cc3ccccc3s2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19NO5S/c1-8-13(18)15(20)14(19)10(22-8)7-17-16(21)12-6-9-4-2-3-5-11(9)23-12/h2-6,8,10,13-15,18-20H,7H2,1H3,(H,17,21)/t8-,10+,13+,14+,15+/m0/s1 |
| InChIKey | IPSOZVTWFFHVDS-QFJYNZAASA-N |
| XLogP | 0.50 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |