C14H19ClFN6O4P — CID 155530398
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-[[methoxy(methyl)phosphoryl]amino]propylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155530398) has the molecular formula C14H19ClFN6O4P and a molecular weight of 420.77 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-[[methoxy(methyl)phosphoryl]amino]propylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-[[methoxy(methyl)phosphoryl]amino]propylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155530398 |
| Molecular Formula | C14H19ClFN6O4P |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[3-[[methoxy(methyl)phosphoryl]amino]propylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COP(C)(=O)NCCCNc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C14H19ClFN6O4P/c1-25-27(2,24)18-7-3-6-17-13-12(21-26-22-13)14(20-23)19-9-4-5-11(16)10(15)8-9/h4-5,8,23H,3,6-7H2,1-2H3,(H,17,22)(H,18,24)(H,19,20) |
| InChIKey | MWGXCLCSLRKGMQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|