C21H18F8N2O2 — CID 155530530
6-[2-[bis(3,3,3-trifluoropropyl)amino]ethoxy]-1,3-difluoro-10H-acridin-9-one (PubChem CID 155530530) has the molecular formula C21H18F8N2O2 and a molecular weight of 482.37 g/mol. Its IUPAC name is 6-[2-[bis(3,3,3-trifluoropropyl)amino]ethoxy]-1,3-difluoro-10H-acridin-9-one.
| Compound Name | 6-[2-[bis(3,3,3-trifluoropropyl)amino]ethoxy]-1,3-difluoro-10H-acridin-9-one |
|---|---|
| PubChem CID | 155530530 |
| Molecular Formula | C21H18F8N2O2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 6-[2-[bis(3,3,3-trifluoropropyl)amino]ethoxy]-1,3-difluoro-10H-acridin-9-one |
| SMILES | O=c1c2ccc(OCCN(CCC(F)(F)F)CCC(F)(F)F)cc2[nH]c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C21H18F8N2O2/c22-12-9-15(23)18-17(10-12)30-16-11-13(1-2-14(16)19(18)32)33-8-7-31(5-3-20(24,25)26)6-4-21(27,28)29/h1-2,9-11H,3-8H2,(H,30,32) |
| InChIKey | RJEFXAXTFWJIIJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|