C25H34F3N7O7 — CID 155530694
4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 155530694) has the molecular formula C25H34F3N7O7 and a molecular weight of 601.58 g/mol. Its IUPAC name is 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155530694 |
| Molecular Formula | C25H34F3N7O7 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H33N7O5.C2HF3O2/c1-2-3-10-35-22-28-19(25)18-20(29-22)30(23(32)27-18)15-16-4-6-17(7-5-16)21(31)26-9-12-34-14-13-33-11-8-24;3-2(4,5)1(6)7/h4-7H,2-3,8-15,24H2,1H3,(H,26,31)(H,27,32)(H2,25,28,29);(H,6,7) |
| InChIKey | AQBMDOQPSQWEBU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 209.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|