C19H16N2O — CID 155530786
(1E,3E,6E,8E)-1,9-dipyridin-3-ylnona-1,3,6,8-tetraen-5-one (PubChem CID 155530786) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is (1E,3E,6E,8E)-1,9-dipyridin-3-ylnona-1,3,6,8-tetraen-5-one.
| Compound Name | (1E,3E,6E,8E)-1,9-dipyridin-3-ylnona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 155530786 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (1E,3E,6E,8E)-1,9-dipyridin-3-ylnona-1,3,6,8-tetraen-5-one |
| SMILES | O=C(/C=C/C=C/c1cccnc1)/C=C/C=C/c1cccnc1 |
| InChI | InChI=1S/C19H16N2O/c22-19(11-3-1-7-17-9-5-13-20-15-17)12-4-2-8-18-10-6-14-21-16-18/h1-16H/b7-1+,8-2+,11-3+,12-4+ |
| InChIKey | IXKJTXDCKNDHLL-BYFFUFPCSA-N |
| XLogP | 3.88 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|