About (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine
(NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine (PubChem CID 155530985) has the molecular formula C10H7F6NO
and a molecular weight of 271.16 g/mol. Its IUPAC name is (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine |
| PubChem CID | 155530985 |
| Molecular Formula | C10H7F6NO |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine |
| SMILES | O/N=C/Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6NO/c11-9(12,13)7-3-6(1-2-17-18)4-8(5-7)10(14,15)16/h2-5,18H,1H2/b17-2+ |
| InChIKey | WLQWUQJCUCSLTE-LAZPYJJCSA-N |
| XLogP | 3.73 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine?
The IUPAC name of (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine (CID 155530985) is (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine is O/N=C/Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine?
The InChIKey is WLQWUQJCUCSLTE-LAZPYJJCSA-N. The full InChI is InChI=1S/C10H7F6NO/c11-9(12,13)7-3-6(1-2-17-18)4-8(5-7)10(14,15)16/h2-5,18H,1H2/b17-2+.
What are the key properties of (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine?
(NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine has a molecular weight of 271.16 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[2-[3,5-bis(trifluoromethyl)phenyl]ethylidene]hydroxylamine is sourced from PubChem (CID 155530985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).