C14H17BrFN7O4S — CID 155531191
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155531191) has the molecular formula C14H17BrFN7O4S and a molecular weight of 478.30 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155531191 |
| Molecular Formula | C14H17BrFN7O4S |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CN1CCN(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)S1(=O)=O |
| InChI | InChI=1S/C14H17BrFN7O4S/c1-22-6-7-23(28(22,25)26)5-4-17-13-12(20-27-21-13)14(19-24)18-9-2-3-11(16)10(15)8-9/h2-3,8,24H,4-7H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | FNEWXSTUZWFXFZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|