C18H19FN4 — CID 155531380
1-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 155531380) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 155531380 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-N-[[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NCc2cn[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN4/c1-23(2)17-9-7-16(8-10-17)20-11-14-12-21-22-18(14)13-3-5-15(19)6-4-13/h3-10,12,20H,11H2,1-2H3,(H,21,22) |
| InChIKey | JCZIUZBVBPQRJX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|