C28H38O10 — CID 155531443
[(2R,3S,3aS,4R,5E,9S,10R,12E)-3a,4,9-triacetyloxy-10-hydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-3-yl] acetate (PubChem CID 155531443) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is [(2R,3S,3aS,4R,5E,9S,10R,12E)-3a,4,9-triacetyloxy-10-hydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-3-yl] acetate.
| Compound Name | [(2R,3S,3aS,4R,5E,9S,10R,12E)-3a,4,9-triacetyloxy-10-hydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-3-yl] acetate |
|---|---|
| PubChem CID | 155531443 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | [(2R,3S,3aS,4R,5E,9S,10R,12E)-3a,4,9-triacetyloxy-10-hydroxy-2,5,8,8,12-pentamethyl-11-oxo-2,3,4,7,9,10-hexahydrocyclopenta[12]annulen-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)C(=O)/C(C)=C/C2=C[C@@H](C)[C@H](OC(C)=O)[C@]2(OC(C)=O)[C@H](OC(C)=O)/C(C)=C/CC1(C)C |
| InChI | InChI=1S/C28H38O10/c1-14-10-11-27(8,9)26(37-19(6)31)23(34)22(33)15(2)12-21-13-16(3)25(36-18(5)30)28(21,38-20(7)32)24(14)35-17(4)29/h10,12-13,16,23-26,34H,11H2,1-9H3/b14-10+,15-12+/t16-,23+,24-,25+,26-,28-/m1/s1 |
| InChIKey | VBVDIRGTWZOBGH-BRCKENRMSA-N |
| XLogP | 2.91 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|