C23H32O2 — CID 155531457
(1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(E)-3-phenylprop-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 155531457) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is (1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(E)-3-phenylprop-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(E)-3-phenylprop-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 155531457 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(E)-3-phenylprop-2-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H32O2/c1-17-12-13-20-22(2,15-14-21(25)23(20,3)16-24)19(17)11-7-10-18-8-5-4-6-9-18/h4-10,19-21,24-25H,1,11-16H2,2-3H3/b10-7+/t19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | YFRKHXMWWXHTRT-WYQIRTEWSA-N |
| XLogP | 4.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|