C19H20O5 — CID 155531470
(1S,11S,12R,13S,18R)-17,18-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione (PubChem CID 155531470) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (1S,11S,12R,13S,18R)-17,18-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione.
| Compound Name | (1S,11S,12R,13S,18R)-17,18-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
|---|---|
| PubChem CID | 155531470 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (1S,11S,12R,13S,18R)-17,18-dihydroxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
| SMILES | Cc1cc(=O)cc2c3c1[C@H](O)[C@@H]1[C@@H]4OC(=O)[C@](CC2)(C(C)C4O)[C@H]31 |
| InChI | InChI=1S/C19H20O5/c1-7-5-10(20)6-9-3-4-19-8(2)15(21)17(24-18(19)23)13-14(19)12(9)11(7)16(13)22/h5-6,8,13-17,21-22H,3-4H2,1-2H3/t8?,13-,14-,15?,16+,17+,19-/m1/s1 |
| InChIKey | KGRCSNHPSYENDC-XJBBVPOESA-N |
| XLogP | 0.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |