About 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide
2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide (PubChem CID 155531698) has the molecular formula C18H21BrN2O2
and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide.
Molecular Properties
| Compound Name | 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide |
| PubChem CID | 155531698 |
| Molecular Formula | C18H21BrN2O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide |
| SMILES | Cc1n(C(C)C)c2c([n+]1C(C)C)C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C18H21N2O2.BrH/c1-10(2)19-12(5)20(11(3)4)16-15(19)17(21)13-8-6-7-9-14(13)18(16)22;/h6-11H,1-5H3;1H/q+1;/p-1 |
| InChIKey | FDUHDJLIPKZDHS-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide?
The IUPAC name of 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide (CID 155531698) is 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide.
What is the SMILES notation for 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide?
The canonical SMILES for 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide is Cc1n(C(C)C)c2c([n+]1C(C)C)C(=O)c1ccccc1C2=O.[Br-].
What is the InChIKey of 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide?
The InChIKey is FDUHDJLIPKZDHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H21N2O2.BrH/c1-10(2)19-12(5)20(11(3)4)16-15(19)17(21)13-8-6-7-9-14(13)18(16)22;/h6-11H,1-5H3;1H/q+1;/p-1.
What are the key properties of 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide?
2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide has a molecular weight of 377.28 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-di(propan-2-yl)benzo[f]benzimidazol-3-ium-4,9-dione bromide is sourced from PubChem (CID 155531698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).