C32H41N7O — CID 155531701
4-(cyclohexylamino)-1-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 155531701) has the molecular formula C32H41N7O and a molecular weight of 539.73 g/mol. Its IUPAC name is 4-(cyclohexylamino)-1-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-1-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155531701 |
| Molecular Formula | C32H41N7O |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 4-(cyclohexylamino)-1-ethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCCCC3)c(C(=O)NCCCCNc3c4c(nc5ccccc35)CCCC4)cnc21 |
| InChI | InChI=1S/C32H41N7O/c1-2-39-31-25(21-36-39)30(37-22-12-4-3-5-13-22)26(20-35-31)32(40)34-19-11-10-18-33-29-23-14-6-8-16-27(23)38-28-17-9-7-15-24(28)29/h6,8,14,16,20-22H,2-5,7,9-13,15,17-19H2,1H3,(H,33,38)(H,34,40)(H,35,37) |
| InChIKey | ULESJOXPFUVABR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|