C30H36N4O5 — CID 155531853
(2S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanamide (PubChem CID 155531853) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanamide.
| Compound Name | (2S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanamide |
|---|---|
| PubChem CID | 155531853 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (2S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]hexanamide |
| SMILES | CCCC[C@H](NC(=O)/C=C/c1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H36N4O5/c1-2-3-14-24(33-26(35)16-15-21-10-6-4-7-11-21)29(38)34-25(19-23-17-18-31-28(23)37)27(36)30(39)32-20-22-12-8-5-9-13-22/h4-13,15-16,23-25H,2-3,14,17-20H2,1H3,(H,31,37)(H,32,39)(H,33,35)(H,34,38)/b16-15+/t23-,24-,25-/m0/s1 |
| InChIKey | PCAFFLJHZAJAQW-DOAZHDKUSA-N |
| XLogP | 2.27 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|