C26H40O6 — CID 155531913
(2E,4E,6Z)-6-[(E,4R,6S,8R,10S)-10-(acetyloxymethyl)-2,4,6,8-tetramethyldodec-2-enylidene]hepta-2,4-dienedioic acid (PubChem CID 155531913) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is (2E,4E,6Z)-6-[(E,4R,6S,8R,10S)-10-(acetyloxymethyl)-2,4,6,8-tetramethyldodec-2-enylidene]hepta-2,4-dienedioic acid.
| Compound Name | (2E,4E,6Z)-6-[(E,4R,6S,8R,10S)-10-(acetyloxymethyl)-2,4,6,8-tetramethyldodec-2-enylidene]hepta-2,4-dienedioic acid |
|---|---|
| PubChem CID | 155531913 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (2E,4E,6Z)-6-[(E,4R,6S,8R,10S)-10-(acetyloxymethyl)-2,4,6,8-tetramethyldodec-2-enylidene]hepta-2,4-dienedioic acid |
| SMILES | CCC(COC(C)=O)C[C@H](C)C[C@H](C)C[C@@H](C)/C=C(C)/C=C(/C=C/C=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H40O6/c1-7-23(17-32-22(6)27)15-20(4)13-18(2)12-19(3)14-21(5)16-24(26(30)31)10-8-9-11-25(28)29/h8-11,14,16,18-20,23H,7,12-13,15,17H2,1-6H3,(H,28,29)(H,30,31)/b10-8+,11-9+,21-14+,24-16-/t18-,19-,20-,23?/m1/s1 |
| InChIKey | ZYGNASYDERYKGT-UZMNYRIZSA-N |
| XLogP | 5.81 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|