C21H19N3O3S — CID 155531915
2-[4-(4-acetylanilino)pyrimidin-2-yl]sulfanyl-1-(4-methoxyphenyl)ethanone (PubChem CID 155531915) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[4-(4-acetylanilino)pyrimidin-2-yl]sulfanyl-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[4-(4-acetylanilino)pyrimidin-2-yl]sulfanyl-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 155531915 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[4-(4-acetylanilino)pyrimidin-2-yl]sulfanyl-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CSc2nccc(Nc3ccc(C(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-14(25)15-3-7-17(8-4-15)23-20-11-12-22-21(24-20)28-13-19(26)16-5-9-18(27-2)10-6-16/h3-12H,13H2,1-2H3,(H,22,23,24) |
| InChIKey | OZDBMQGKJNKZIN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |