C15H20O4 — CID 155532054
(3R,3aR,8aS,9aR)-8-hydroxy-3,5,8a-trimethyl-3a,4,7,8,9,9a-hexahydro-3H-benzo[f][1]benzofuran-2,6-dione (PubChem CID 155532054) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3R,3aR,8aS,9aR)-8-hydroxy-3,5,8a-trimethyl-3a,4,7,8,9,9a-hexahydro-3H-benzo[f][1]benzofuran-2,6-dione.
| Compound Name | (3R,3aR,8aS,9aR)-8-hydroxy-3,5,8a-trimethyl-3a,4,7,8,9,9a-hexahydro-3H-benzo[f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 155532054 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3R,3aR,8aS,9aR)-8-hydroxy-3,5,8a-trimethyl-3a,4,7,8,9,9a-hexahydro-3H-benzo[f][1]benzofuran-2,6-dione |
| SMILES | CC1=C2C[C@H]3[C@@H](C[C@]2(C)C(O)CC1=O)OC(=O)[C@@H]3C |
| InChI | InChI=1S/C15H20O4/c1-7-9-4-10-8(2)11(16)5-13(17)15(10,3)6-12(9)19-14(7)18/h7,9,12-13,17H,4-6H2,1-3H3/t7-,9-,12-,13?,15+/m1/s1 |
| InChIKey | COIRNPAUKDQXLQ-UUHRHNHQSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |