C32H38F3N3O — CID 155532060
(E)-N-[5-[4-[[propan-2-yl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 155532060) has the molecular formula C32H38F3N3O and a molecular weight of 537.67 g/mol. Its IUPAC name is (E)-N-[5-[4-[[propan-2-yl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[propan-2-yl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 155532060 |
| Molecular Formula | C32H38F3N3O |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (E)-N-[5-[4-[[propan-2-yl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(CCc1cccc(C(F)(F)F)c1)Cc1ccc(CCCCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C32H38F3N3O/c1-25(2)38(21-18-27-9-6-11-30(22-27)32(33,34)35)24-29-14-12-26(13-15-29)8-4-3-5-20-37-31(39)17-16-28-10-7-19-36-23-28/h6-7,9-17,19,22-23,25H,3-5,8,18,20-21,24H2,1-2H3,(H,37,39)/b17-16+ |
| InChIKey | QFVVZSFFNIYPPV-WUKNDPDISA-N |
| XLogP | 7.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|