C19H13BrF2N2O3 — CID 155532127
6-bromo-3'-[2-(2,4-difluorophenyl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 155532127) has the molecular formula C19H13BrF2N2O3 and a molecular weight of 435.22 g/mol. Its IUPAC name is 6-bromo-3'-[2-(2,4-difluorophenyl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-bromo-3'-[2-(2,4-difluorophenyl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 155532127 |
| Molecular Formula | C19H13BrF2N2O3 |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 6-bromo-3'-[2-(2,4-difluorophenyl)-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C(CN1C(=O)NC2(CCc3cc(Br)ccc32)C1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H13BrF2N2O3/c20-11-1-4-14-10(7-11)5-6-19(14)17(26)24(18(27)23-19)9-16(25)13-3-2-12(21)8-15(13)22/h1-4,7-8H,5-6,9H2,(H,23,27) |
| InChIKey | CNKRKEVCVHPEJI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|