C23H24ClNO3 — CID 155532205
7-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]oxy-3,4-dimethylchromen-2-one (PubChem CID 155532205) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is 7-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]oxy-3,4-dimethylchromen-2-one.
| Compound Name | 7-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]oxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 155532205 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 7-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]oxy-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OC3CCN(Cc4cccc(Cl)c4)CC3)cc2oc1=O |
| InChI | InChI=1S/C23H24ClNO3/c1-15-16(2)23(26)28-22-13-20(6-7-21(15)22)27-19-8-10-25(11-9-19)14-17-4-3-5-18(24)12-17/h3-7,12-13,19H,8-11,14H2,1-2H3 |
| InChIKey | HWTRGPWDQGKEJX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|