C27H22N10O2S2 — CID 155532242
2-[4-[[11-(4-methylanilino)-13-phenyl-8-thia-3,4,5,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-yl]amino]phenyl]sulfonylguanidine (PubChem CID 155532242) has the molecular formula C27H22N10O2S2 and a molecular weight of 582.68 g/mol. Its IUPAC name is 2-[4-[[11-(4-methylanilino)-13-phenyl-8-thia-3,4,5,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-yl]amino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[[11-(4-methylanilino)-13-phenyl-8-thia-3,4,5,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-yl]amino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 155532242 |
| Molecular Formula | C27H22N10O2S2 |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | 2-[4-[[11-(4-methylanilino)-13-phenyl-8-thia-3,4,5,10,12-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-yl]amino]phenyl]sulfonylguanidine |
| SMILES | Cc1ccc(Nc2nc(-c3ccccc3)c3c(n2)sc2c(Nc4ccc(S(=O)(=O)N=C(N)N)cc4)nnnc23)cc1 |
| InChI | InChI=1S/C27H22N10O2S2/c1-15-7-9-18(10-8-15)31-27-32-21(16-5-3-2-4-6-16)20-22-23(40-25(20)33-27)24(35-37-34-22)30-17-11-13-19(14-12-17)41(38,39)36-26(28)29/h2-14H,1H3,(H4,28,29,36)(H,30,34,35)(H,31,32,33) |
| InChIKey | LLTSNVWXRGQYTQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 187.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|