C17H26N6O2 — CID 155532305
(3R,5S)-5-[[(2E)-2-[(2-piperidin-1-ylpyrimidin-5-yl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid (PubChem CID 155532305) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is (3R,5S)-5-[[(2E)-2-[(2-piperidin-1-ylpyrimidin-5-yl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[[(2E)-2-[(2-piperidin-1-ylpyrimidin-5-yl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155532305 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3R,5S)-5-[[(2E)-2-[(2-piperidin-1-ylpyrimidin-5-yl)methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](CN/N=C/c2cnc(N3CCCCC3)nc2)C1 |
| InChI | InChI=1S/C17H26N6O2/c24-16(25)15-6-13(7-18-12-15)10-21-22-11-14-8-19-17(20-9-14)23-4-2-1-3-5-23/h8-9,11,13,15,18,21H,1-7,10,12H2,(H,24,25)/b22-11+/t13-,15+/m0/s1 |
| InChIKey | SVWBZRMTBNCLIE-VBOCIMTHSA-N |
| XLogP | 0.70 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|